C14H17NO4S — CID 118588645
2-[(3-methylsulfanylphenoxy)carbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 118588645) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-[(3-methylsulfanylphenoxy)carbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(3-methylsulfanylphenoxy)carbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118588645 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[(3-methylsulfanylphenoxy)carbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)Oc1cccc(SC)c1 |
| InChI | InChI=1S/C14H17NO4S/c1-10(2)13(16)18-8-7-15-14(17)19-11-5-4-6-12(9-11)20-3/h4-6,9H,1,7-8H2,2-3H3,(H,15,17) |
| InChIKey | PTBSBLXXLZLNPS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|