C15H19NO4 — CID 143902345
2-[(4-ethylphenoxy)carbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 143902345) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[(4-ethylphenoxy)carbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(4-ethylphenoxy)carbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 143902345 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-[(4-ethylphenoxy)carbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)Oc1ccc(CC)cc1 |
| InChI | InChI=1S/C15H19NO4/c1-4-12-5-7-13(8-6-12)20-15(18)16-9-10-19-14(17)11(2)3/h5-8H,2,4,9-10H2,1,3H3,(H,16,18) |
| InChIKey | VGWVZGPEWAZDMU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|