C24H28ClNO5S — CID 155718950
2-[[1-(4-chlorophenyl)sulfanyl-3-(4-ethylphenoxy)propan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 155718950) has the molecular formula C24H28ClNO5S and a molecular weight of 478.01 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)sulfanyl-3-(4-ethylphenoxy)propan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[1-(4-chlorophenyl)sulfanyl-3-(4-ethylphenoxy)propan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155718950 |
| Molecular Formula | C24H28ClNO5S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)sulfanyl-3-(4-ethylphenoxy)propan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OC(COc1ccc(CC)cc1)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H28ClNO5S/c1-4-18-5-9-20(10-6-18)30-15-21(16-32-22-11-7-19(25)8-12-22)31-24(28)26-13-14-29-23(27)17(2)3/h5-12,21H,2,4,13-16H2,1,3H3,(H,26,28) |
| InChIKey | XUBLVRLULSWOSK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|