C21H31NO6 — CID 123694545
2-[[3-(ethoxymethyl)-2-methyl-4-phenoxybutan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 123694545) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is 2-[[3-(ethoxymethyl)-2-methyl-4-phenoxybutan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[3-(ethoxymethyl)-2-methyl-4-phenoxybutan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123694545 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 2-[[3-(ethoxymethyl)-2-methyl-4-phenoxybutan-2-yl]oxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OC(C)(C)C(COCC)COc1ccccc1 |
| InChI | InChI=1S/C21H31NO6/c1-6-25-14-17(15-27-18-10-8-7-9-11-18)21(4,5)28-20(24)22-12-13-26-19(23)16(2)3/h7-11,17H,2,6,12-15H2,1,3-5H3,(H,22,24) |
| InChIKey | GFNXVDGRPIAZAX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|