C31H37NO11 — CID 118331643
2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 4-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]-3-phenoxypropoxy]benzoate (PubChem CID 118331643) has the molecular formula C31H37NO11 and a molecular weight of 599.63 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 4-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]-3-phenoxypropoxy]benzoate.
| Compound Name | 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 4-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]-3-phenoxypropoxy]benzoate |
|---|---|
| PubChem CID | 118331643 |
| Molecular Formula | C31H37NO11 |
| Molecular Weight | 599.63 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 4-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]-3-phenoxypropoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OC(COc1ccccc1)COc1ccc(C(=O)OCCOCCOC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C31H37NO11/c1-22(2)28(33)38-15-14-32-31(36)43-27(20-41-25-8-6-5-7-9-25)21-42-26-12-10-24(11-13-26)30(35)40-19-17-37-16-18-39-29(34)23(3)4/h5-13,27H,1,3,14-21H2,2,4H3,(H,32,36) |
| InChIKey | XFUPVCYPXGVEMA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.63 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|