C21H26O7 — CID 58004905
2-[2,3-bis(2-methylprop-2-enoyloxy)propoxy]ethyl 4-methylbenzoate (PubChem CID 58004905) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is 2-[2,3-bis(2-methylprop-2-enoyloxy)propoxy]ethyl 4-methylbenzoate.
| Compound Name | 2-[2,3-bis(2-methylprop-2-enoyloxy)propoxy]ethyl 4-methylbenzoate |
|---|---|
| PubChem CID | 58004905 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[2,3-bis(2-methylprop-2-enoyloxy)propoxy]ethyl 4-methylbenzoate |
| SMILES | C=C(C)C(=O)OCC(COCCOC(=O)c1ccc(C)cc1)OC(=O)C(=C)C |
| InChI | InChI=1S/C21H26O7/c1-14(2)19(22)27-13-18(28-20(23)15(3)4)12-25-10-11-26-21(24)17-8-6-16(5)7-9-17/h6-9,18H,1,3,10-13H2,2,4-5H3 |
| InChIKey | KODCAKGISMLMSI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|