C40H38O10 — CID 59221186
4-O-[9-methyl-7-(4-methylbenzoyl)oxy-9H-fluoren-2-yl] 1-O-[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl] benzene-1,4-dicarboxylate (PubChem CID 59221186) has the molecular formula C40H38O10 and a molecular weight of 678.73 g/mol. Its IUPAC name is 4-O-[9-methyl-7-(4-methylbenzoyl)oxy-9H-fluoren-2-yl] 1-O-[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl] benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[9-methyl-7-(4-methylbenzoyl)oxy-9H-fluoren-2-yl] 1-O-[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 59221186 |
| Molecular Formula | C40H38O10 |
| Molecular Weight | 678.73 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | 4-O-[9-methyl-7-(4-methylbenzoyl)oxy-9H-fluoren-2-yl] 1-O-[2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl] benzene-1,4-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCOCCOCCOC(=O)c1ccc(C(=O)Oc2ccc3c(c2)C(C)c2cc(OC(=O)c4ccc(C)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C40H38O10/c1-25(2)37(41)47-21-19-45-17-18-46-20-22-48-38(42)28-9-11-30(12-10-28)40(44)50-32-14-16-34-33-15-13-31(23-35(33)27(4)36(34)24-32)49-39(43)29-7-5-26(3)6-8-29/h5-16,23-24,27H,1,17-22H2,2-4H3 |
| InChIKey | LZWPSQGFYRGYFN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.73 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|