C40H36O11 — CID 160947336
[4-[2-[4-[4-[2-(2-oxopropanoyloxy)ethyl]benzoyl]oxybenzoyl]oxyethyl]phenyl] 4-[2-(2-methylprop-2-enoyloxy)ethyl]benzoate (PubChem CID 160947336) has the molecular formula C40H36O11 and a molecular weight of 692.72 g/mol. Its IUPAC name is [4-[2-[4-[4-[2-(2-oxopropanoyloxy)ethyl]benzoyl]oxybenzoyl]oxyethyl]phenyl] 4-[2-(2-methylprop-2-enoyloxy)ethyl]benzoate.
| Compound Name | [4-[2-[4-[4-[2-(2-oxopropanoyloxy)ethyl]benzoyl]oxybenzoyl]oxyethyl]phenyl] 4-[2-(2-methylprop-2-enoyloxy)ethyl]benzoate |
|---|---|
| PubChem CID | 160947336 |
| Molecular Formula | C40H36O11 |
| Molecular Weight | 692.72 g/mol |
| Exact Mass | 692.23 |
| IUPAC Name | [4-[2-[4-[4-[2-(2-oxopropanoyloxy)ethyl]benzoyl]oxybenzoyl]oxyethyl]phenyl] 4-[2-(2-methylprop-2-enoyloxy)ethyl]benzoate |
| SMILES | C=C(C)C(=O)OCCc1ccc(C(=O)Oc2ccc(CCOC(=O)c3ccc(OC(=O)c4ccc(CCOC(=O)C(C)=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H36O11/c1-26(2)36(42)47-23-20-28-4-10-32(11-5-28)39(45)50-34-16-8-30(9-17-34)22-25-49-38(44)31-14-18-35(19-15-31)51-40(46)33-12-6-29(7-13-33)21-24-48-37(43)27(3)41/h4-19H,1,20-25H2,2-3H3 |
| InChIKey | JQKXGRGFMLXSIV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.72 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|