C32H30O10 — CID 130417195
2-[4-[4-(2-methylprop-2-enoyloxymethoxy)benzoyl]oxyphenyl]ethyl 4-(2-methylprop-2-enoyloxymethoxy)benzoate (PubChem CID 130417195) has the molecular formula C32H30O10 and a molecular weight of 574.58 g/mol. Its IUPAC name is 2-[4-[4-(2-methylprop-2-enoyloxymethoxy)benzoyl]oxyphenyl]ethyl 4-(2-methylprop-2-enoyloxymethoxy)benzoate.
| Compound Name | 2-[4-[4-(2-methylprop-2-enoyloxymethoxy)benzoyl]oxyphenyl]ethyl 4-(2-methylprop-2-enoyloxymethoxy)benzoate |
|---|---|
| PubChem CID | 130417195 |
| Molecular Formula | C32H30O10 |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 2-[4-[4-(2-methylprop-2-enoyloxymethoxy)benzoyl]oxyphenyl]ethyl 4-(2-methylprop-2-enoyloxymethoxy)benzoate |
| SMILES | C=C(C)C(=O)OCOc1ccc(C(=O)OCCc2ccc(OC(=O)c3ccc(OCOC(=O)C(=C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H30O10/c1-21(2)29(33)40-19-38-26-13-7-24(8-14-26)31(35)37-18-17-23-5-11-28(12-6-23)42-32(36)25-9-15-27(16-10-25)39-20-41-30(34)22(3)4/h5-16H,1,3,17-20H2,2,4H3 |
| InChIKey | SJTLUSCECOWROH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|