C25H26O7 — CID 58370779
2-[4-(3-methyl-2-oxobut-3-enoxy)phenyl]ethyl 4-(2-methylprop-2-enoyloxymethoxy)benzoate (PubChem CID 58370779) has the molecular formula C25H26O7 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[4-(3-methyl-2-oxobut-3-enoxy)phenyl]ethyl 4-(2-methylprop-2-enoyloxymethoxy)benzoate.
| Compound Name | 2-[4-(3-methyl-2-oxobut-3-enoxy)phenyl]ethyl 4-(2-methylprop-2-enoyloxymethoxy)benzoate |
|---|---|
| PubChem CID | 58370779 |
| Molecular Formula | C25H26O7 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-[4-(3-methyl-2-oxobut-3-enoxy)phenyl]ethyl 4-(2-methylprop-2-enoyloxymethoxy)benzoate |
| SMILES | C=C(C)C(=O)COc1ccc(CCOC(=O)c2ccc(OCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C25H26O7/c1-17(2)23(26)15-30-21-9-5-19(6-10-21)13-14-29-25(28)20-7-11-22(12-8-20)31-16-32-24(27)18(3)4/h5-12H,1,3,13-16H2,2,4H3 |
| InChIKey | IHSRTSYIXKWKST-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|