C25H24O5 — CID 58471671
[4-[2-[4-(3-methyl-2-oxobut-3-enoxy)phenyl]ethynyl]phenyl]methoxymethyl 2-methylprop-2-enoate (PubChem CID 58471671) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is [4-[2-[4-(3-methyl-2-oxobut-3-enoxy)phenyl]ethynyl]phenyl]methoxymethyl 2-methylprop-2-enoate.
| Compound Name | [4-[2-[4-(3-methyl-2-oxobut-3-enoxy)phenyl]ethynyl]phenyl]methoxymethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58471671 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [4-[2-[4-(3-methyl-2-oxobut-3-enoxy)phenyl]ethynyl]phenyl]methoxymethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)COc1ccc(C#Cc2ccc(COCOC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C25H24O5/c1-18(2)24(26)16-29-23-13-11-21(12-14-23)6-5-20-7-9-22(10-8-20)15-28-17-30-25(27)19(3)4/h7-14H,1,3,15-17H2,2,4H3 |
| InChIKey | CNCWYHYIIWMLOJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|