C39H32O6 — CID 118605709
[4-[4-[3-(2-methylprop-2-enoyloxy)-4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethynyl]phenyl]phenyl]phenyl]methyl 2-methylprop-2-enoate (PubChem CID 118605709) has the molecular formula C39H32O6 and a molecular weight of 596.68 g/mol. Its IUPAC name is [4-[4-[3-(2-methylprop-2-enoyloxy)-4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethynyl]phenyl]phenyl]phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[4-[3-(2-methylprop-2-enoyloxy)-4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethynyl]phenyl]phenyl]phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118605709 |
| Molecular Formula | C39H32O6 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | [4-[4-[3-(2-methylprop-2-enoyloxy)-4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethynyl]phenyl]phenyl]phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccc(-c2ccc(-c3ccc(C#Cc4ccc(OC(=O)C(=C)C)cc4)c(OC(=O)C(=C)C)c3)cc2)cc1 |
| InChI | InChI=1S/C39H32O6/c1-25(2)37(40)43-24-29-8-12-30(13-9-29)31-15-17-32(18-16-31)34-20-19-33(36(23-34)45-39(42)27(5)6)14-7-28-10-21-35(22-11-28)44-38(41)26(3)4/h8-13,15-23H,1,3,5,24H2,2,4,6H3 |
| InChIKey | POKMAPGHOJXCJE-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|