C40H29FO8 — CID 118605926
[5-[2-[4-[4-(2-fluoroprop-2-enoyloxy)phenyl]-2-(2-methylprop-2-enoyloxy)phenyl]ethynyl]-2-(4-prop-2-enoyloxyphenyl)phenyl] 2-methylprop-2-enoate (PubChem CID 118605926) has the molecular formula C40H29FO8 and a molecular weight of 656.66 g/mol. Its IUPAC name is [5-[2-[4-[4-(2-fluoroprop-2-enoyloxy)phenyl]-2-(2-methylprop-2-enoyloxy)phenyl]ethynyl]-2-(4-prop-2-enoyloxyphenyl)phenyl] 2-methylprop-2-enoate.
| Compound Name | [5-[2-[4-[4-(2-fluoroprop-2-enoyloxy)phenyl]-2-(2-methylprop-2-enoyloxy)phenyl]ethynyl]-2-(4-prop-2-enoyloxyphenyl)phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118605926 |
| Molecular Formula | C40H29FO8 |
| Molecular Weight | 656.66 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | [5-[2-[4-[4-(2-fluoroprop-2-enoyloxy)phenyl]-2-(2-methylprop-2-enoyloxy)phenyl]ethynyl]-2-(4-prop-2-enoyloxyphenyl)phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(C#Cc3ccc(-c4ccc(OC(=O)C(=C)F)cc4)cc3OC(=O)C(=C)C)cc2OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C40H29FO8/c1-7-37(42)46-32-19-15-29(16-20-32)34-21-9-27(22-36(34)49-39(44)25(4)5)8-10-30-11-12-31(23-35(30)48-38(43)24(2)3)28-13-17-33(18-14-28)47-40(45)26(6)41/h7,9,11-23H,1-2,4,6H2,3,5H3 |
| InChIKey | QQEMPBYUDDZCGT-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.66 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|