C37H27FO6 — CID 118605685
[4-[4-[2-[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]-5-prop-2-enoyloxyphenyl]ethynyl]phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 118605685) has the molecular formula C37H27FO6 and a molecular weight of 586.62 g/mol. Its IUPAC name is [4-[4-[2-[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]-5-prop-2-enoyloxyphenyl]ethynyl]phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[2-[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]-5-prop-2-enoyloxyphenyl]ethynyl]phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118605685 |
| Molecular Formula | C37H27FO6 |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | [4-[4-[2-[2-fluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]-5-prop-2-enoyloxyphenyl]ethynyl]phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(C#Cc2ccc(-c3ccc(OC(=O)C(=C)C)cc3)cc2)c(F)cc1-c1ccc(OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C37H27FO6/c1-6-35(39)44-34-21-29(33(38)22-32(34)28-15-19-31(20-16-28)43-37(41)24(4)5)12-9-25-7-10-26(11-8-25)27-13-17-30(18-14-27)42-36(40)23(2)3/h6-8,10-11,13-22H,1-2,4H2,3,5H3 |
| InChIKey | OHZOWYRJMUIKMY-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|