C39H23FO6 — CID 118605524
[4-[2-[4-[2-[5-fluoro-2-prop-2-enoyloxy-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethynyl]phenyl]ethynyl]phenyl] prop-2-enoate (PubChem CID 118605524) has the molecular formula C39H23FO6 and a molecular weight of 606.61 g/mol. Its IUPAC name is [4-[2-[4-[2-[5-fluoro-2-prop-2-enoyloxy-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethynyl]phenyl]ethynyl]phenyl] prop-2-enoate.
| Compound Name | [4-[2-[4-[2-[5-fluoro-2-prop-2-enoyloxy-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethynyl]phenyl]ethynyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 118605524 |
| Molecular Formula | C39H23FO6 |
| Molecular Weight | 606.61 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | [4-[2-[4-[2-[5-fluoro-2-prop-2-enoyloxy-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethynyl]phenyl]ethynyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C#Cc2ccc(C#Cc3cc(F)c(C#Cc4ccc(OC(=O)C=C)cc4)cc3OC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C39H23FO6/c1-4-37(41)44-33-21-15-29(16-22-33)12-9-27-7-10-28(11-8-27)14-20-32-25-35(40)31(26-36(32)46-39(43)6-3)19-13-30-17-23-34(24-18-30)45-38(42)5-2/h4-8,10-11,15-18,21-26H,1-3H2 |
| InChIKey | NOLBYGNLXLIKAZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|