C36H26O8 — CID 118605323
[4-[2-[4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethynyl]-3,5-di(prop-2-enoyloxy)phenyl]ethynyl]phenyl] 2-methylprop-2-enoate (PubChem CID 118605323) has the molecular formula C36H26O8 and a molecular weight of 586.60 g/mol. Its IUPAC name is [4-[2-[4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethynyl]-3,5-di(prop-2-enoyloxy)phenyl]ethynyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethynyl]-3,5-di(prop-2-enoyloxy)phenyl]ethynyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118605323 |
| Molecular Formula | C36H26O8 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | [4-[2-[4-[2-[4-(2-methylprop-2-enoyloxy)phenyl]ethynyl]-3,5-di(prop-2-enoyloxy)phenyl]ethynyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1cc(C#Cc2ccc(OC(=O)C(=C)C)cc2)cc(OC(=O)C=C)c1C#Cc1ccc(OC(=O)C(=C)C)cc1 |
| InChI | InChI=1S/C36H26O8/c1-7-33(37)43-31-21-27(10-9-25-11-16-28(17-12-25)41-35(39)23(3)4)22-32(44-34(38)8-2)30(31)20-15-26-13-18-29(19-14-26)42-36(40)24(5)6/h7-8,11-14,16-19,21-22H,1-3,5H2,4,6H3 |
| InChIKey | SBRXLIIDEDSPDB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|