C39H28O6 — CID 118605588
[4-[2-[4-[2-(2-methylprop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]phenyl]ethynyl]phenyl] 2-methylprop-2-enoate (PubChem CID 118605588) has the molecular formula C39H28O6 and a molecular weight of 592.65 g/mol. Its IUPAC name is [4-[2-[4-[2-(2-methylprop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]phenyl]ethynyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-[4-[2-(2-methylprop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]phenyl]ethynyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118605588 |
| Molecular Formula | C39H28O6 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | [4-[2-[4-[2-(2-methylprop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]phenyl]ethynyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C#Cc2ccc(-c3ccc(C#Cc4ccc(OC(=O)C(=C)C)cc4)cc3)c(OC(=O)C(=C)C)c2)cc1 |
| InChI | InChI=1S/C39H28O6/c1-6-37(40)43-33-20-13-30(14-21-33)9-10-31-17-24-35(36(25-31)45-39(42)27(4)5)32-18-11-28(12-19-32)7-8-29-15-22-34(23-16-29)44-38(41)26(2)3/h6,11-25H,1-2,4H2,3,5H3 |
| InChIKey | VCUMYIQZAMVUDO-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|