C35H26O8 — CID 123652834
[4-[2-[3-methyl-2,6-di(prop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethenyl]phenyl] prop-2-enoate (PubChem CID 123652834) has the molecular formula C35H26O8 and a molecular weight of 574.59 g/mol. Its IUPAC name is [4-[2-[3-methyl-2,6-di(prop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethenyl]phenyl] prop-2-enoate.
| Compound Name | [4-[2-[3-methyl-2,6-di(prop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethenyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 123652834 |
| Molecular Formula | C35H26O8 |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | [4-[2-[3-methyl-2,6-di(prop-2-enoyloxy)-4-[2-(4-prop-2-enoyloxyphenyl)ethynyl]phenyl]ethenyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C#Cc2cc(OC(=O)C=C)c(C=Cc3ccc(OC(=O)C=C)cc3)c(OC(=O)C=C)c2C)cc1 |
| InChI | InChI=1S/C35H26O8/c1-6-31(36)40-27-17-11-24(12-18-27)10-16-26-22-30(42-33(38)8-3)29(35(23(26)5)43-34(39)9-4)21-15-25-13-19-28(20-14-25)41-32(37)7-2/h6-9,11-15,17-22H,1-4H2,5H3 |
| InChIKey | SZMMUIJWTFNPNT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|