C60H48N2O2 — CID 59302166
[4-(4-methyl-N-[4-[2-[10-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]anthracen-9-yl]ethenyl]phenyl]anilino)phenyl] prop-2-enoate (PubChem CID 59302166) has the molecular formula C60H48N2O2 and a molecular weight of 829.06 g/mol. Its IUPAC name is [4-(4-methyl-N-[4-[2-[10-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]anthracen-9-yl]ethenyl]phenyl]anilino)phenyl] prop-2-enoate.
| Compound Name | [4-(4-methyl-N-[4-[2-[10-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]anthracen-9-yl]ethenyl]phenyl]anilino)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 59302166 |
| Molecular Formula | C60H48N2O2 |
| Molecular Weight | 829.06 g/mol |
| Exact Mass | 828.37 |
| IUPAC Name | [4-(4-methyl-N-[4-[2-[10-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethenyl]anthracen-9-yl]ethenyl]phenyl]anilino)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(N(c2ccc(C)cc2)c2ccc(C=Cc3c4ccccc4c(C=Cc4ccc(N(c5ccc(C)cc5)c5ccc(C)cc5)cc4)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C60H48N2O2/c1-5-60(63)64-53-38-36-52(37-39-53)62(49-30-18-44(4)19-31-49)51-34-22-46(23-35-51)25-41-59-56-12-8-6-10-54(56)58(55-11-7-9-13-57(55)59)40-24-45-20-32-50(33-21-45)61(47-26-14-42(2)15-27-47)48-28-16-43(3)17-29-48/h5-41H,1H2,2-4H3 |
| InChIKey | HDJCLAZUAAKNAU-UHFFFAOYSA-N |
| XLogP | 16.29 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.06 |
| LogP ≤ 5 | 16.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|