C60H45N3O4 — CID 58520163
[4-[4-[N-[3,5-bis(N-phenylanilino)phenyl]-4-(4-prop-2-enoyloxyphenyl)anilino]phenyl]phenyl] prop-2-enoate (PubChem CID 58520163) has the molecular formula C60H45N3O4 and a molecular weight of 872.04 g/mol. Its IUPAC name is [4-[4-[N-[3,5-bis(N-phenylanilino)phenyl]-4-(4-prop-2-enoyloxyphenyl)anilino]phenyl]phenyl] prop-2-enoate.
| Compound Name | [4-[4-[N-[3,5-bis(N-phenylanilino)phenyl]-4-(4-prop-2-enoyloxyphenyl)anilino]phenyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 58520163 |
| Molecular Formula | C60H45N3O4 |
| Molecular Weight | 872.04 g/mol |
| Exact Mass | 871.34 |
| IUPAC Name | [4-[4-[N-[3,5-bis(N-phenylanilino)phenyl]-4-(4-prop-2-enoyloxyphenyl)anilino]phenyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(N(c3ccc(-c4ccc(OC(=O)C=C)cc4)cc3)c3cc(N(c4ccccc4)c4ccccc4)cc(N(c4ccccc4)c4ccccc4)c3)cc2)cc1 |
| InChI | InChI=1S/C60H45N3O4/c1-3-59(64)66-57-37-29-46(30-38-57)44-25-33-52(34-26-44)63(53-35-27-45(28-36-53)47-31-39-58(40-32-47)67-60(65)4-2)56-42-54(61(48-17-9-5-10-18-48)49-19-11-6-12-20-49)41-55(43-56)62(50-21-13-7-14-22-50)51-23-15-8-16-24-51/h3-43H,1-2H2 |
| InChIKey | SIWNHAASAUTKAF-UHFFFAOYSA-N |
| XLogP | 15.61 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.04 |
| LogP ≤ 5 | 15.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|