C31H25NO4 — CID 22089909
[4-[4-[N-methyl-4-(4-prop-2-enoyloxyphenyl)anilino]phenyl]phenyl] prop-2-enoate (PubChem CID 22089909) has the molecular formula C31H25NO4 and a molecular weight of 475.54 g/mol. Its IUPAC name is [4-[4-[N-methyl-4-(4-prop-2-enoyloxyphenyl)anilino]phenyl]phenyl] prop-2-enoate.
| Compound Name | [4-[4-[N-methyl-4-(4-prop-2-enoyloxyphenyl)anilino]phenyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 22089909 |
| Molecular Formula | C31H25NO4 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | [4-[4-[N-methyl-4-(4-prop-2-enoyloxyphenyl)anilino]phenyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(N(C)c3ccc(-c4ccc(OC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H25NO4/c1-4-30(33)35-28-18-10-24(11-19-28)22-6-14-26(15-7-22)32(3)27-16-8-23(9-17-27)25-12-20-29(21-13-25)36-31(34)5-2/h4-21H,1-2H2,3H3 |
| InChIKey | SMWOFAOCRHGHEU-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|