C54H44N2O4 — CID 58807715
[4-(4-methyl-N-[4-[2-[4-[2-[4-(4-methyl-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]anilino)phenyl] prop-2-enoate (PubChem CID 58807715) has the molecular formula C54H44N2O4 and a molecular weight of 784.96 g/mol. Its IUPAC name is [4-(4-methyl-N-[4-[2-[4-[2-[4-(4-methyl-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]anilino)phenyl] prop-2-enoate.
| Compound Name | [4-(4-methyl-N-[4-[2-[4-[2-[4-(4-methyl-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]anilino)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 58807715 |
| Molecular Formula | C54H44N2O4 |
| Molecular Weight | 784.96 g/mol |
| Exact Mass | 784.33 |
| IUPAC Name | [4-(4-methyl-N-[4-[2-[4-[2-[4-(4-methyl-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]anilino)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(N(c2ccc(C)cc2)c2ccc(C=Cc3ccc(C=Cc4ccc(N(c5ccc(C)cc5)c5ccc(OC(=O)C=C)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C54H44N2O4/c1-5-53(57)59-51-35-31-49(32-36-51)55(45-23-7-39(3)8-24-45)47-27-19-43(20-28-47)17-15-41-11-13-42(14-12-41)16-18-44-21-29-48(30-22-44)56(46-25-9-40(4)10-26-46)50-33-37-52(38-34-50)60-54(58)6-2/h5-38H,1-2H2,3-4H3 |
| InChIKey | UABYEQIDRHJAIR-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.96 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|