C56H42Cl2N2O4 — CID 58520199
[4-[4-[N-[2-chloro-4-[3-chloro-4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]-4-(4-prop-2-enoyloxyphenyl)anilino]phenyl]phenyl] prop-2-enoate (PubChem CID 58520199) has the molecular formula C56H42Cl2N2O4 and a molecular weight of 877.87 g/mol. Its IUPAC name is [4-[4-[N-[2-chloro-4-[3-chloro-4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]-4-(4-prop-2-enoyloxyphenyl)anilino]phenyl]phenyl] prop-2-enoate.
| Compound Name | [4-[4-[N-[2-chloro-4-[3-chloro-4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]-4-(4-prop-2-enoyloxyphenyl)anilino]phenyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 58520199 |
| Molecular Formula | C56H42Cl2N2O4 |
| Molecular Weight | 877.87 g/mol |
| Exact Mass | 876.25 |
| IUPAC Name | [4-[4-[N-[2-chloro-4-[3-chloro-4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl]-4-(4-prop-2-enoyloxyphenyl)anilino]phenyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc(N(c3ccc(-c4ccc(OC(=O)C=C)cc4)cc3)c3ccc(-c4ccc(N(c5ccc(C)cc5)c5ccc(C)cc5)c(Cl)c4)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C56H42Cl2N2O4/c1-5-55(61)63-49-29-15-41(16-30-49)39-11-25-47(26-12-39)60(48-27-13-40(14-28-48)42-17-31-50(32-18-42)64-56(62)6-2)54-34-20-44(36-52(54)58)43-19-33-53(51(57)35-43)59(45-21-7-37(3)8-22-45)46-23-9-38(4)10-24-46/h5-36H,1-2H2,3-4H3 |
| InChIKey | GFABJSVXHUFXRF-UHFFFAOYSA-N |
| XLogP | 15.73 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.87 |
| LogP ≤ 5 | 15.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|