C24H18ClNO4 — CID 59832803
[4-(N-(4-chlorophenyl)-4-prop-2-enoyloxyanilino)phenyl] prop-2-enoate (PubChem CID 59832803) has the molecular formula C24H18ClNO4 and a molecular weight of 419.86 g/mol. Its IUPAC name is [4-(N-(4-chlorophenyl)-4-prop-2-enoyloxyanilino)phenyl] prop-2-enoate.
| Compound Name | [4-(N-(4-chlorophenyl)-4-prop-2-enoyloxyanilino)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 59832803 |
| Molecular Formula | C24H18ClNO4 |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | [4-(N-(4-chlorophenyl)-4-prop-2-enoyloxyanilino)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(N(c2ccc(Cl)cc2)c2ccc(OC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C24H18ClNO4/c1-3-23(27)29-21-13-9-19(10-14-21)26(18-7-5-17(25)6-8-18)20-11-15-22(16-12-20)30-24(28)4-2/h3-16H,1-2H2 |
| InChIKey | SRBQULFWEJLEPZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|