C63H63NO6 — CID 59832713
[4-[1-[4-[4-[1-(4-prop-2-enoyloxyphenyl)cyclohexyl]-N-[4-[1-(4-prop-2-enoyloxyphenyl)cyclohexyl]phenyl]anilino]phenyl]cyclohexyl]phenyl] prop-2-enoate (PubChem CID 59832713) has the molecular formula C63H63NO6 and a molecular weight of 930.20 g/mol. Its IUPAC name is [4-[1-[4-[4-[1-(4-prop-2-enoyloxyphenyl)cyclohexyl]-N-[4-[1-(4-prop-2-enoyloxyphenyl)cyclohexyl]phenyl]anilino]phenyl]cyclohexyl]phenyl] prop-2-enoate.
| Compound Name | [4-[1-[4-[4-[1-(4-prop-2-enoyloxyphenyl)cyclohexyl]-N-[4-[1-(4-prop-2-enoyloxyphenyl)cyclohexyl]phenyl]anilino]phenyl]cyclohexyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 59832713 |
| Molecular Formula | C63H63NO6 |
| Molecular Weight | 930.20 g/mol |
| Exact Mass | 929.47 |
| IUPAC Name | [4-[1-[4-[4-[1-(4-prop-2-enoyloxyphenyl)cyclohexyl]-N-[4-[1-(4-prop-2-enoyloxyphenyl)cyclohexyl]phenyl]anilino]phenyl]cyclohexyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C2(c3ccc(N(c4ccc(C5(c6ccc(OC(=O)C=C)cc6)CCCCC5)cc4)c4ccc(C5(c6ccc(OC(=O)C=C)cc6)CCCCC5)cc4)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C63H63NO6/c1-4-58(65)68-55-34-22-49(23-35-55)61(40-10-7-11-41-61)46-16-28-52(29-17-46)64(53-30-18-47(19-31-53)62(42-12-8-13-43-62)50-24-36-56(37-25-50)69-59(66)5-2)54-32-20-48(21-33-54)63(44-14-9-15-45-63)51-26-38-57(39-27-51)70-60(67)6-3/h4-6,16-39H,1-3,7-15,40-45H2 |
| InChIKey | ILRWZDVRXWYQRV-UHFFFAOYSA-N |
| XLogP | 15.18 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.20 |
| LogP ≤ 5 | 15.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|