C41H41NO2 — CID 58814424
[4-[1-[4-(4-methyl-N-[4-(4-methylphenyl)phenyl]anilino)phenyl]cyclohexyl]phenyl] propanoate (PubChem CID 58814424) has the molecular formula C41H41NO2 and a molecular weight of 579.78 g/mol. Its IUPAC name is [4-[1-[4-(4-methyl-N-[4-(4-methylphenyl)phenyl]anilino)phenyl]cyclohexyl]phenyl] propanoate.
| Compound Name | [4-[1-[4-(4-methyl-N-[4-(4-methylphenyl)phenyl]anilino)phenyl]cyclohexyl]phenyl] propanoate |
|---|---|
| PubChem CID | 58814424 |
| Molecular Formula | C41H41NO2 |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | [4-[1-[4-(4-methyl-N-[4-(4-methylphenyl)phenyl]anilino)phenyl]cyclohexyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(C2(c3ccc(N(c4ccc(C)cc4)c4ccc(-c5ccc(C)cc5)cc4)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C41H41NO2/c1-4-40(43)44-39-26-18-35(19-27-39)41(28-6-5-7-29-41)34-16-24-38(25-17-34)42(36-20-10-31(3)11-21-36)37-22-14-33(15-23-37)32-12-8-30(2)9-13-32/h8-27H,4-7,28-29H2,1-3H3 |
| InChIKey | TXVVVHORAYHKHJ-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|