C57H51NO6 — CID 20582060
[4-[1-[4-[3-[(E)-2-[4-(N-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]-4-methylanilino)phenyl]ethenyl]phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate (PubChem CID 20582060) has the molecular formula C57H51NO6 and a molecular weight of 846.04 g/mol. Its IUPAC name is [4-[1-[4-[3-[(E)-2-[4-(N-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]-4-methylanilino)phenyl]ethenyl]phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate.
| Compound Name | [4-[1-[4-[3-[(E)-2-[4-(N-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]-4-methylanilino)phenyl]ethenyl]phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate |
|---|---|
| PubChem CID | 20582060 |
| Molecular Formula | C57H51NO6 |
| Molecular Weight | 846.04 g/mol |
| Exact Mass | 845.37 |
| IUPAC Name | [4-[1-[4-[3-[(E)-2-[4-(N-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]-4-methylanilino)phenyl]ethenyl]phenoxy]carbonyloxyphenyl]cyclohexyl]phenyl] acetate |
| SMILES | COc1cccc(/C=C/c2ccc(N(c3ccc(C)cc3)c3ccc(/C=C/c4cccc(OC(=O)Oc5ccc(C6(c7ccc(OC(C)=O)cc7)CCCCC6)cc5)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C57H51NO6/c1-41-13-27-49(28-14-41)58(50-29-19-43(20-30-50)15-17-45-9-7-11-54(39-45)61-3)51-31-21-44(22-32-51)16-18-46-10-8-12-55(40-46)64-56(60)63-53-35-25-48(26-36-53)57(37-5-4-6-38-57)47-23-33-52(34-24-47)62-42(2)59/h7-36,39-40H,4-6,37-38H2,1-3H3/b17-15+,18-16+ |
| InChIKey | WUGFEBYNVWLUNW-YTEMWHBBSA-N |
| XLogP | 14.57 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.04 |
| LogP ≤ 5 | 14.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|