C40H35NO5 — CID 20582103
[3-[(E)-2-[4-(N-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-4-methylanilino)phenyl]ethenyl]phenyl] 2-oxopropyl carbonate (PubChem CID 20582103) has the molecular formula C40H35NO5 and a molecular weight of 609.72 g/mol. Its IUPAC name is [3-[(E)-2-[4-(N-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-4-methylanilino)phenyl]ethenyl]phenyl] 2-oxopropyl carbonate.
| Compound Name | [3-[(E)-2-[4-(N-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-4-methylanilino)phenyl]ethenyl]phenyl] 2-oxopropyl carbonate |
|---|---|
| PubChem CID | 20582103 |
| Molecular Formula | C40H35NO5 |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | [3-[(E)-2-[4-(N-[4-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl]-4-methylanilino)phenyl]ethenyl]phenyl] 2-oxopropyl carbonate |
| SMILES | COc1ccc(/C=C/c2ccc(N(c3ccc(C)cc3)c3ccc(/C=C/c4cccc(OC(=O)OCC(C)=O)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H35NO5/c1-29-7-19-35(20-8-29)41(36-21-13-31(14-22-36)9-10-33-17-25-38(44-3)26-18-33)37-23-15-32(16-24-37)11-12-34-5-4-6-39(27-34)46-40(43)45-28-30(2)42/h4-27H,28H2,1-3H3/b10-9+,12-11+ |
| InChIKey | WBSPHNWSVBNSPD-HULFFUFUSA-N |
| XLogP | 9.92 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|