C52H43NO5 — CID 20582106
[4-[(E)-2-[4-(N-[4-(2,2-diphenylethenyl)phenyl]-4-methylanilino)phenyl]-1-(4-methoxyphenyl)ethenyl]phenyl] 2-oxopropyl carbonate (PubChem CID 20582106) has the molecular formula C52H43NO5 and a molecular weight of 761.92 g/mol. Its IUPAC name is [4-[(E)-2-[4-(N-[4-(2,2-diphenylethenyl)phenyl]-4-methylanilino)phenyl]-1-(4-methoxyphenyl)ethenyl]phenyl] 2-oxopropyl carbonate.
| Compound Name | [4-[(E)-2-[4-(N-[4-(2,2-diphenylethenyl)phenyl]-4-methylanilino)phenyl]-1-(4-methoxyphenyl)ethenyl]phenyl] 2-oxopropyl carbonate |
|---|---|
| PubChem CID | 20582106 |
| Molecular Formula | C52H43NO5 |
| Molecular Weight | 761.92 g/mol |
| Exact Mass | 761.31 |
| IUPAC Name | [4-[(E)-2-[4-(N-[4-(2,2-diphenylethenyl)phenyl]-4-methylanilino)phenyl]-1-(4-methoxyphenyl)ethenyl]phenyl] 2-oxopropyl carbonate |
| SMILES | COc1ccc(/C(=C\c2ccc(N(c3ccc(C)cc3)c3ccc(C=C(c4ccccc4)c4ccccc4)cc3)cc2)c2ccc(OC(=O)OCC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C52H43NO5/c1-37-14-24-45(25-15-37)53(46-26-16-39(17-27-46)34-50(41-10-6-4-7-11-41)42-12-8-5-9-13-42)47-28-18-40(19-29-47)35-51(43-20-30-48(56-3)31-21-43)44-22-32-49(33-23-44)58-52(55)57-36-38(2)54/h4-35H,36H2,1-3H3/b51-35+ |
| InChIKey | GSVNLRSJTUFPOF-QTSWVIMHSA-N |
| XLogP | 12.76 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.92 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|