C42H37NO2 — CID 54214278
N-[4-[4-[2,2-bis(4-methoxyphenyl)ethenyl]phenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline (PubChem CID 54214278) has the molecular formula C42H37NO2 and a molecular weight of 587.76 g/mol. Its IUPAC name is N-[4-[4-[2,2-bis(4-methoxyphenyl)ethenyl]phenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline.
| Compound Name | N-[4-[4-[2,2-bis(4-methoxyphenyl)ethenyl]phenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 54214278 |
| Molecular Formula | C42H37NO2 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | N-[4-[4-[2,2-bis(4-methoxyphenyl)ethenyl]phenyl]phenyl]-4-methyl-N-(4-methylphenyl)aniline |
| SMILES | COc1ccc(C(=Cc2ccc(-c3ccc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H37NO2/c1-30-5-19-37(20-6-30)43(38-21-7-31(2)8-22-38)39-23-13-34(14-24-39)33-11-9-32(10-12-33)29-42(35-15-25-40(44-3)26-16-35)36-17-27-41(45-4)28-18-36/h5-29H,1-4H3 |
| InChIKey | PYAWEAKIMBNTJX-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|