C36H33NOS2 — CID 73461398
[4-[2-[4-[N-(4-methoxyphenyl)-4-(sulfanylmethyl)anilino]phenyl]-1-(4-methylphenyl)ethenyl]phenyl]methanethiol (PubChem CID 73461398) has the molecular formula C36H33NOS2 and a molecular weight of 559.80 g/mol. Its IUPAC name is [4-[2-[4-[N-(4-methoxyphenyl)-4-(sulfanylmethyl)anilino]phenyl]-1-(4-methylphenyl)ethenyl]phenyl]methanethiol.
| Compound Name | [4-[2-[4-[N-(4-methoxyphenyl)-4-(sulfanylmethyl)anilino]phenyl]-1-(4-methylphenyl)ethenyl]phenyl]methanethiol |
|---|---|
| PubChem CID | 73461398 |
| Molecular Formula | C36H33NOS2 |
| Molecular Weight | 559.80 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | [4-[2-[4-[N-(4-methoxyphenyl)-4-(sulfanylmethyl)anilino]phenyl]-1-(4-methylphenyl)ethenyl]phenyl]methanethiol |
| SMILES | COc1ccc(N(c2ccc(C=C(c3ccc(C)cc3)c3ccc(CS)cc3)cc2)c2ccc(CS)cc2)cc1 |
| InChI | InChI=1S/C36H33NOS2/c1-26-3-11-30(12-4-26)36(31-13-5-28(24-39)6-14-31)23-27-7-15-32(16-8-27)37(33-17-9-29(25-40)10-18-33)34-19-21-35(38-2)22-20-34/h3-23,39-40H,24-25H2,1-2H3 |
| InChIKey | DKPSOJAGNOGEGF-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.80 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|