C60H48N2O2 — CID 163788418
4-[(Z)-2-(4-methoxyphenyl)-2-[4-[(E)-1-(4-methoxyphenyl)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diphenylaniline (PubChem CID 163788418) has the molecular formula C60H48N2O2 and a molecular weight of 829.06 g/mol. Its IUPAC name is 4-[(Z)-2-(4-methoxyphenyl)-2-[4-[(E)-1-(4-methoxyphenyl)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diphenylaniline.
| Compound Name | 4-[(Z)-2-(4-methoxyphenyl)-2-[4-[(E)-1-(4-methoxyphenyl)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 163788418 |
| Molecular Formula | C60H48N2O2 |
| Molecular Weight | 829.06 g/mol |
| Exact Mass | 828.37 |
| IUPAC Name | 4-[(Z)-2-(4-methoxyphenyl)-2-[4-[(E)-1-(4-methoxyphenyl)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diphenylaniline |
| SMILES | COc1ccc(/C(=C\c2ccc(N(c3ccccc3)c3ccccc3)cc2)c2ccc(/C(=C\c3ccc(N(c4ccccc4)c4ccccc4)cc3)c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C60H48N2O2/c1-63-57-39-31-49(32-40-57)59(43-45-23-35-55(36-24-45)61(51-15-7-3-8-16-51)52-17-9-4-10-18-52)47-27-29-48(30-28-47)60(50-33-41-58(64-2)42-34-50)44-46-25-37-56(38-26-46)62(53-19-11-5-12-20-53)54-21-13-6-14-22-54/h3-44H,1-2H3/b59-43-,60-44+ |
| InChIKey | MUOJHDXMHIAKQT-ZIWRJYSASA-N |
| XLogP | 15.82 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.06 |
| LogP ≤ 5 | 15.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|