C58H50N4O4 — CID 132507926
1-N,4-N-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine (PubChem CID 132507926) has the molecular formula C58H50N4O4 and a molecular weight of 867.06 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 132507926 |
| Molecular Formula | C58H50N4O4 |
| Molecular Weight | 867.06 g/mol |
| Exact Mass | 866.38 |
| IUPAC Name | 1-N,4-N-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(N(c3ccccc3)c3ccc(N(c4ccccc4)c4ccc(N(c5ccc(OC)cc5)c5ccc(OC)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C58H50N4O4/c1-63-55-35-27-51(28-36-55)61(52-29-37-56(64-2)38-30-52)49-23-19-47(20-24-49)59(43-11-7-5-8-12-43)45-15-17-46(18-16-45)60(44-13-9-6-10-14-44)48-21-25-50(26-22-48)62(53-31-39-57(65-3)40-32-53)54-33-41-58(66-4)42-34-54/h5-42H,1-4H3 |
| InChIKey | CXUWGGFZRCJRJT-UHFFFAOYSA-N |
| XLogP | 15.60 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.06 |
| LogP ≤ 5 | 15.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |