C58H50N4O2 — CID 59738736
1-N,4-N-bis[4-(4-methoxy-N-(3-methylphenyl)anilino)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine (PubChem CID 59738736) has the molecular formula C58H50N4O2 and a molecular weight of 835.06 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(4-methoxy-N-(3-methylphenyl)anilino)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis[4-(4-methoxy-N-(3-methylphenyl)anilino)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 59738736 |
| Molecular Formula | C58H50N4O2 |
| Molecular Weight | 835.06 g/mol |
| Exact Mass | 834.39 |
| IUPAC Name | 1-N,4-N-bis[4-(4-methoxy-N-(3-methylphenyl)anilino)phenyl]-1-N,4-N-diphenylbenzene-1,4-diamine |
| SMILES | COc1ccc(N(c2ccc(N(c3ccccc3)c3ccc(N(c4ccccc4)c4ccc(N(c5ccc(OC)cc5)c5cccc(C)c5)cc4)cc3)cc2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C58H50N4O2/c1-43-13-11-19-55(41-43)61(53-33-37-57(63-3)38-34-53)51-29-25-49(26-30-51)59(45-15-7-5-8-16-45)47-21-23-48(24-22-47)60(46-17-9-6-10-18-46)50-27-31-52(32-28-50)62(56-20-12-14-44(2)42-56)54-35-39-58(64-4)40-36-54/h5-42H,1-4H3 |
| InChIKey | YDYVNKMUCMSGLP-UHFFFAOYSA-N |
| XLogP | 16.20 |
| TPSA | 31.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.06 |
| LogP ≤ 5 | 16.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |