C21H23N — CID 145208007
ethane;3-methyl-N,N-diphenylaniline (PubChem CID 145208007) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is ethane;3-methyl-N,N-diphenylaniline.
| Compound Name | ethane;3-methyl-N,N-diphenylaniline |
|---|---|
| PubChem CID | 145208007 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | ethane;3-methyl-N,N-diphenylaniline |
| SMILES | CC.Cc1cccc(N(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C19H17N.C2H6/c1-16-9-8-14-19(15-16)20(17-10-4-2-5-11-17)18-12-6-3-7-13-18;1-2/h2-15H,1H3;1-2H3 |
| InChIKey | IYXDNWBBOVSUSO-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |