C38H34N2O2 — CID 139606544
5-N,7-N-bis(4-methoxyphenyl)-5-N,7-N-bis(3-methylphenyl)azulene-5,7-diamine (PubChem CID 139606544) has the molecular formula C38H34N2O2 and a molecular weight of 550.70 g/mol. Its IUPAC name is 5-N,7-N-bis(4-methoxyphenyl)-5-N,7-N-bis(3-methylphenyl)azulene-5,7-diamine.
| Compound Name | 5-N,7-N-bis(4-methoxyphenyl)-5-N,7-N-bis(3-methylphenyl)azulene-5,7-diamine |
|---|---|
| PubChem CID | 139606544 |
| Molecular Formula | C38H34N2O2 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 5-N,7-N-bis(4-methoxyphenyl)-5-N,7-N-bis(3-methylphenyl)azulene-5,7-diamine |
| SMILES | COc1ccc(N(c2cccc(C)c2)c2cc3cccc-3cc(N(c3ccc(OC)cc3)c3cccc(C)c3)c2)cc1 |
| InChI | InChI=1S/C38H34N2O2/c1-27-8-5-12-33(22-27)39(31-14-18-37(41-3)19-15-31)35-24-29-10-7-11-30(29)25-36(26-35)40(34-13-6-9-28(2)23-34)32-16-20-38(42-4)21-17-32/h5-26H,1-4H3 |
| InChIKey | HSSGUDKZWYUUNQ-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |