C80H72BN4O6- — CID 158446549
tris[4-(3-methoxy-N-(3-methoxyphenyl)anilino)phenyl]-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]boranuide (PubChem CID 158446549) has the molecular formula C80H72BN4O6- and a molecular weight of 1196.29 g/mol. Its IUPAC name is tris[4-(3-methoxy-N-(3-methoxyphenyl)anilino)phenyl]-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]boranuide.
| Compound Name | tris[4-(3-methoxy-N-(3-methoxyphenyl)anilino)phenyl]-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]boranuide |
|---|---|
| PubChem CID | 158446549 |
| Molecular Formula | C80H72BN4O6- |
| Molecular Weight | 1196.29 g/mol |
| Exact Mass | 1195.56 |
| IUPAC Name | tris[4-(3-methoxy-N-(3-methoxyphenyl)anilino)phenyl]-[4-(3-methyl-N-(3-methylphenyl)anilino)phenyl]boranuide |
| SMILES | COc1cccc(N(c2ccc([B-](c3ccc(N(c4cccc(C)c4)c4cccc(C)c4)cc3)(c3ccc(N(c4cccc(OC)c4)c4cccc(OC)c4)cc3)c3ccc(N(c4cccc(OC)c4)c4cccc(OC)c4)cc3)cc2)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C80H72BN4O6/c1-57-17-9-19-67(49-57)82(68-20-10-18-58(2)50-68)63-41-33-59(34-42-63)81(60-35-43-64(44-36-60)83(69-21-11-27-75(51-69)86-3)70-22-12-28-76(52-70)87-4,61-37-45-65(46-38-61)84(71-23-13-29-77(53-71)88-5)72-24-14-30-78(54-72)89-6)62-39-47-66(48-40-62)85(73-25-15-31-79(55-73)90-7)74-26-16-32-80(56-74)91-8/h9-56H,1-8H3/q-1 |
| InChIKey | YCJZMIJFRRXLEU-UHFFFAOYSA-N |
| XLogP | 17.61 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 91 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1196.29 |
| LogP ≤ 5 | 17.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|