C42H36N2O4 — CID 18996817
3-methoxy-N-[4-[2-[4-(3-methoxy-N-(3-methoxyphenyl)anilino)phenyl]ethynyl]phenyl]-N-(3-methoxyphenyl)aniline (PubChem CID 18996817) has the molecular formula C42H36N2O4 and a molecular weight of 632.76 g/mol. Its IUPAC name is 3-methoxy-N-[4-[2-[4-(3-methoxy-N-(3-methoxyphenyl)anilino)phenyl]ethynyl]phenyl]-N-(3-methoxyphenyl)aniline.
| Compound Name | 3-methoxy-N-[4-[2-[4-(3-methoxy-N-(3-methoxyphenyl)anilino)phenyl]ethynyl]phenyl]-N-(3-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 18996817 |
| Molecular Formula | C42H36N2O4 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.27 |
| IUPAC Name | 3-methoxy-N-[4-[2-[4-(3-methoxy-N-(3-methoxyphenyl)anilino)phenyl]ethynyl]phenyl]-N-(3-methoxyphenyl)aniline |
| SMILES | COc1cccc(N(c2ccc(C#Cc3ccc(N(c4cccc(OC)c4)c4cccc(OC)c4)cc3)cc2)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C42H36N2O4/c1-45-39-13-5-9-35(27-39)43(36-10-6-14-40(28-36)46-2)33-23-19-31(20-24-33)17-18-32-21-25-34(26-22-32)44(37-11-7-15-41(29-37)47-3)38-12-8-16-42(30-38)48-4/h5-16,19-30H,1-4H3 |
| InChIKey | LMXXFALNNXZMTF-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|