C58H49N3O3 — CID 58939356
N-[4-[bis[4-(N-(3-methoxyphenyl)anilino)phenyl]methyl]phenyl]-3-methoxy-N-phenylaniline (PubChem CID 58939356) has the molecular formula C58H49N3O3 and a molecular weight of 836.05 g/mol. Its IUPAC name is N-[4-[bis[4-(N-(3-methoxyphenyl)anilino)phenyl]methyl]phenyl]-3-methoxy-N-phenylaniline.
| Compound Name | N-[4-[bis[4-(N-(3-methoxyphenyl)anilino)phenyl]methyl]phenyl]-3-methoxy-N-phenylaniline |
|---|---|
| PubChem CID | 58939356 |
| Molecular Formula | C58H49N3O3 |
| Molecular Weight | 836.05 g/mol |
| Exact Mass | 835.38 |
| IUPAC Name | N-[4-[bis[4-(N-(3-methoxyphenyl)anilino)phenyl]methyl]phenyl]-3-methoxy-N-phenylaniline |
| SMILES | COc1cccc(N(c2ccccc2)c2ccc(C(c3ccc(N(c4ccccc4)c4cccc(OC)c4)cc3)c3ccc(N(c4ccccc4)c4cccc(OC)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C58H49N3O3/c1-62-55-25-13-22-52(40-55)59(46-16-7-4-8-17-46)49-34-28-43(29-35-49)58(44-30-36-50(37-31-44)60(47-18-9-5-10-19-47)53-23-14-26-56(41-53)63-2)45-32-38-51(39-33-45)61(48-20-11-6-12-21-48)54-24-15-27-57(42-54)64-3/h4-42,58H,1-3H3 |
| InChIKey | WCYYJDOECKEYEB-UHFFFAOYSA-N |
| XLogP | 15.30 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.05 |
| LogP ≤ 5 | 15.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|