C57H46N4O3 — CID 126595640
3-(N-[4-[4-(N-(3-methoxyphenyl)anilino)-N-[4-(N-(3-methoxyphenyl)anilino)phenyl]anilino]phenyl]anilino)benzaldehyde (PubChem CID 126595640) has the molecular formula C57H46N4O3 and a molecular weight of 835.02 g/mol. Its IUPAC name is 3-(N-[4-[4-(N-(3-methoxyphenyl)anilino)-N-[4-(N-(3-methoxyphenyl)anilino)phenyl]anilino]phenyl]anilino)benzaldehyde.
| Compound Name | 3-(N-[4-[4-(N-(3-methoxyphenyl)anilino)-N-[4-(N-(3-methoxyphenyl)anilino)phenyl]anilino]phenyl]anilino)benzaldehyde |
|---|---|
| PubChem CID | 126595640 |
| Molecular Formula | C57H46N4O3 |
| Molecular Weight | 835.02 g/mol |
| Exact Mass | 834.36 |
| IUPAC Name | 3-(N-[4-[4-(N-(3-methoxyphenyl)anilino)-N-[4-(N-(3-methoxyphenyl)anilino)phenyl]anilino]phenyl]anilino)benzaldehyde |
| SMILES | COc1cccc(N(c2ccccc2)c2ccc(N(c3ccc(N(c4ccccc4)c4cccc(C=O)c4)cc3)c3ccc(N(c4ccccc4)c4cccc(OC)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C57H46N4O3/c1-63-56-25-13-23-54(40-56)60(45-18-8-4-9-19-45)51-35-29-48(30-36-51)58(47-27-33-50(34-28-47)59(44-16-6-3-7-17-44)53-22-12-15-43(39-53)42-62)49-31-37-52(38-32-49)61(46-20-10-5-11-21-46)55-24-14-26-57(41-55)64-2/h3-42H,1-2H3 |
| InChIKey | PHUGZBUXQTXSPU-UHFFFAOYSA-N |
| XLogP | 15.40 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.02 |
| LogP ≤ 5 | 15.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|