C44H37NO2 — CID 166938463
4-[(E)-2-[3,5-bis[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]ethenyl]-N,N-diphenylaniline (PubChem CID 166938463) has the molecular formula C44H37NO2 and a molecular weight of 611.79 g/mol. Its IUPAC name is 4-[(E)-2-[3,5-bis[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]ethenyl]-N,N-diphenylaniline.
| Compound Name | 4-[(E)-2-[3,5-bis[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]ethenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 166938463 |
| Molecular Formula | C44H37NO2 |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | 4-[(E)-2-[3,5-bis[(E)-2-(3-methoxyphenyl)ethenyl]phenyl]ethenyl]-N,N-diphenylaniline |
| SMILES | COc1cccc(/C=C/c2cc(/C=C/c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc(/C=C/c3cccc(OC)c3)c2)c1 |
| InChI | InChI=1S/C44H37NO2/c1-46-43-17-9-11-35(32-43)20-23-38-29-37(30-39(31-38)24-21-36-12-10-18-44(33-36)47-2)22-19-34-25-27-42(28-26-34)45(40-13-5-3-6-14-40)41-15-7-4-8-16-41/h3-33H,1-2H3/b22-19+,23-20+,24-21+ |
| InChIKey | CMPYQYQMIRQMGY-IKVQWSBMSA-N |
| XLogP | 11.68 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|