C62H48N2 — CID 59745960
1-N,1-N,3-N,3-N-tetrakis[4-[(E)-2-phenylethenyl]phenyl]benzene-1,3-diamine (PubChem CID 59745960) has the molecular formula C62H48N2 and a molecular weight of 821.08 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetrakis[4-[(E)-2-phenylethenyl]phenyl]benzene-1,3-diamine.
| Compound Name | 1-N,1-N,3-N,3-N-tetrakis[4-[(E)-2-phenylethenyl]phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 59745960 |
| Molecular Formula | C62H48N2 |
| Molecular Weight | 821.08 g/mol |
| Exact Mass | 820.38 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetrakis[4-[(E)-2-phenylethenyl]phenyl]benzene-1,3-diamine |
| SMILES | C(=C/c1ccc(N(c2ccc(/C=C/c3ccccc3)cc2)c2cccc(N(c3ccc(/C=C/c4ccccc4)cc3)c3ccc(/C=C/c4ccccc4)cc3)c2)cc1)\c1ccccc1 |
| InChI | InChI=1S/C62H48N2/c1-5-14-49(15-6-1)24-28-53-32-40-57(41-33-53)63(58-42-34-54(35-43-58)29-25-50-16-7-2-8-17-50)61-22-13-23-62(48-61)64(59-44-36-55(37-45-59)30-26-51-18-9-3-10-19-51)60-46-38-56(39-47-60)31-27-52-20-11-4-12-21-52/h1-48H/b28-24+,29-25+,30-26+,31-27+ |
| InChIKey | QWXVZLLPDNSVNQ-HLSGMNIQSA-N |
| XLogP | 17.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.08 |
| LogP ≤ 5 | 17.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|