C46H36N2 — CID 14366512
N,N-diphenyl-4-[(E)-2-[3-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]aniline (PubChem CID 14366512) has the molecular formula C46H36N2 and a molecular weight of 616.81 g/mol. Its IUPAC name is N,N-diphenyl-4-[(E)-2-[3-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]aniline.
| Compound Name | N,N-diphenyl-4-[(E)-2-[3-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 14366512 |
| Molecular Formula | C46H36N2 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | N,N-diphenyl-4-[(E)-2-[3-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]aniline |
| SMILES | C(=C/c1cccc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)c1)\c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H36N2/c1-5-16-41(17-6-1)47(42-18-7-2-8-19-42)45-32-28-37(29-33-45)24-26-39-14-13-15-40(36-39)27-25-38-30-34-46(35-31-38)48(43-20-9-3-10-21-43)44-22-11-4-12-23-44/h1-36H/b26-24+,27-25+ |
| InChIKey | JZCQUOLGRQVBLU-OWUYFMIJSA-N |
| XLogP | 12.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|