C46H34Cl2N2 — CID 22900174
3-chloro-N-[4-[(E)-2-[4-[(E)-2-[4-(N-(3-chlorophenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-N-phenylaniline (PubChem CID 22900174) has the molecular formula C46H34Cl2N2 and a molecular weight of 685.70 g/mol. Its IUPAC name is 3-chloro-N-[4-[(E)-2-[4-[(E)-2-[4-(N-(3-chlorophenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-N-phenylaniline.
| Compound Name | 3-chloro-N-[4-[(E)-2-[4-[(E)-2-[4-(N-(3-chlorophenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 22900174 |
| Molecular Formula | C46H34Cl2N2 |
| Molecular Weight | 685.70 g/mol |
| Exact Mass | 684.21 |
| IUPAC Name | 3-chloro-N-[4-[(E)-2-[4-[(E)-2-[4-(N-(3-chlorophenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-N-phenylaniline |
| SMILES | Clc1cccc(N(c2ccccc2)c2ccc(/C=C/c3ccc(/C=C/c4ccc(N(c5ccccc5)c5cccc(Cl)c5)cc4)cc3)cc2)c1 |
| InChI | InChI=1S/C46H34Cl2N2/c47-39-9-7-15-45(33-39)49(41-11-3-1-4-12-41)43-29-25-37(26-30-43)23-21-35-17-19-36(20-18-35)22-24-38-27-31-44(32-28-38)50(42-13-5-2-6-14-42)46-16-8-10-40(48)34-46/h1-34H/b23-21+,24-22+ |
| InChIKey | RTDLPADMQZCINM-MBALSZOMSA-N |
| XLogP | 14.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.70 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|