About 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline
4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline (PubChem CID 20650306) has the molecular formula C26H20ClN
and a molecular weight of 381.91 g/mol. Its IUPAC name is 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline.
Molecular Properties
| Compound Name | 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline |
| PubChem CID | 20650306 |
| Molecular Formula | C26H20ClN |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline |
| SMILES | Clc1ccc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H20ClN/c27-23-17-13-21(14-18-23)11-12-22-15-19-26(20-16-22)28(24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-20H/b12-11+ |
| InChIKey | OYPSZYCHFDMPDH-VAWYXSNFSA-N |
| XLogP | 7.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline?
The IUPAC name of 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline (CID 20650306) is 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline.
What is the SMILES notation for 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline?
The canonical SMILES for 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline is Clc1ccc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1.
What is the InChIKey of 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline?
The InChIKey is OYPSZYCHFDMPDH-VAWYXSNFSA-N. The full InChI is InChI=1S/C26H20ClN/c27-23-17-13-21(14-18-23)11-12-22-15-19-26(20-16-22)28(24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-20H/b12-11+.
What are the key properties of 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline?
4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline has a molecular weight of 381.91 g/mol, XLogP of 7.98, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(4-chlorophenyl)ethenyl]-N,N-diphenylaniline is sourced from PubChem (CID 20650306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).