C69H57N3 — CID 121421564
1-N,3-N,5-N-tris(4-methylphenyl)-1-N,3-N,5-N-tris[4-[(E)-2-phenylethenyl]phenyl]benzene-1,3,5-triamine (PubChem CID 121421564) has the molecular formula C69H57N3 and a molecular weight of 928.24 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(4-methylphenyl)-1-N,3-N,5-N-tris[4-[(E)-2-phenylethenyl]phenyl]benzene-1,3,5-triamine.
| Compound Name | 1-N,3-N,5-N-tris(4-methylphenyl)-1-N,3-N,5-N-tris[4-[(E)-2-phenylethenyl]phenyl]benzene-1,3,5-triamine |
|---|---|
| PubChem CID | 121421564 |
| Molecular Formula | C69H57N3 |
| Molecular Weight | 928.24 g/mol |
| Exact Mass | 927.46 |
| IUPAC Name | 1-N,3-N,5-N-tris(4-methylphenyl)-1-N,3-N,5-N-tris[4-[(E)-2-phenylethenyl]phenyl]benzene-1,3,5-triamine |
| SMILES | Cc1ccc(N(c2ccc(/C=C/c3ccccc3)cc2)c2cc(N(c3ccc(C)cc3)c3ccc(/C=C/c4ccccc4)cc3)cc(N(c3ccc(C)cc3)c3ccc(/C=C/c4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C69H57N3/c1-52-19-37-61(38-20-52)70(64-43-31-58(32-44-64)28-25-55-13-7-4-8-14-55)67-49-68(71(62-39-21-53(2)22-40-62)65-45-33-59(34-46-65)29-26-56-15-9-5-10-16-56)51-69(50-67)72(63-41-23-54(3)24-42-63)66-47-35-60(36-48-66)30-27-57-17-11-6-12-18-57/h4-51H,1-3H3/b28-25+,29-26+,30-27+ |
| InChIKey | FVINURLCDRUFHS-WUOFIQDXSA-N |
| XLogP | 19.53 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.24 |
| LogP ≤ 5 | 19.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|