C49H41N — CID 59805421
4-methyl-N,N-bis[4-[2-[4-(4-methylphenyl)phenyl]ethenyl]phenyl]aniline (PubChem CID 59805421) has the molecular formula C49H41N and a molecular weight of 643.87 g/mol. Its IUPAC name is 4-methyl-N,N-bis[4-[2-[4-(4-methylphenyl)phenyl]ethenyl]phenyl]aniline.
| Compound Name | 4-methyl-N,N-bis[4-[2-[4-(4-methylphenyl)phenyl]ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 59805421 |
| Molecular Formula | C49H41N |
| Molecular Weight | 643.87 g/mol |
| Exact Mass | 643.32 |
| IUPAC Name | 4-methyl-N,N-bis[4-[2-[4-(4-methylphenyl)phenyl]ethenyl]phenyl]aniline |
| SMILES | Cc1ccc(-c2ccc(C=Cc3ccc(N(c4ccc(C)cc4)c4ccc(C=Cc5ccc(-c6ccc(C)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C49H41N/c1-36-4-22-43(23-5-36)45-26-14-39(15-27-45)10-12-41-18-32-48(33-19-41)50(47-30-8-38(3)9-31-47)49-34-20-42(21-35-49)13-11-40-16-28-46(29-17-40)44-24-6-37(2)7-25-44/h4-35H,1-3H3 |
| InChIKey | LDTYYUHWGGIFBL-UHFFFAOYSA-N |
| XLogP | 13.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.87 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|