C52H42N2 — CID 89068068
3-methyl-N-(4-methylphenyl)-N-[4-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]ethenyl]phenyl]phenyl]aniline (PubChem CID 89068068) has the molecular formula C52H42N2 and a molecular weight of 694.92 g/mol. Its IUPAC name is 3-methyl-N-(4-methylphenyl)-N-[4-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]ethenyl]phenyl]phenyl]aniline.
| Compound Name | 3-methyl-N-(4-methylphenyl)-N-[4-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]ethenyl]phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 89068068 |
| Molecular Formula | C52H42N2 |
| Molecular Weight | 694.92 g/mol |
| Exact Mass | 694.33 |
| IUPAC Name | 3-methyl-N-(4-methylphenyl)-N-[4-[4-[(E)-2-[4-[4-(N-phenylanilino)phenyl]phenyl]ethenyl]phenyl]phenyl]aniline |
| SMILES | Cc1ccc(N(c2ccc(-c3ccc(/C=C/c4ccc(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)cc4)cc3)cc2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C52H42N2/c1-39-16-32-49(33-17-39)54(52-15-9-10-40(2)38-52)51-36-30-46(31-37-51)44-26-22-42(23-27-44)19-18-41-20-24-43(25-21-41)45-28-34-50(35-29-45)53(47-11-5-3-6-12-47)48-13-7-4-8-14-48/h3-38H,1-2H3/b19-18+ |
| InChIKey | CCRRJZCMQVKCOO-VHEBQXMUSA-N |
| XLogP | 14.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.92 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|