C54H46N2 — CID 90921715
N-[4-[4-[2-[4-[4-(N-(3,5-dimethylphenyl)anilino)phenyl]phenyl]ethenyl]phenyl]phenyl]-3,5-dimethyl-N-phenylaniline (PubChem CID 90921715) has the molecular formula C54H46N2 and a molecular weight of 722.98 g/mol. Its IUPAC name is N-[4-[4-[2-[4-[4-(N-(3,5-dimethylphenyl)anilino)phenyl]phenyl]ethenyl]phenyl]phenyl]-3,5-dimethyl-N-phenylaniline.
| Compound Name | N-[4-[4-[2-[4-[4-(N-(3,5-dimethylphenyl)anilino)phenyl]phenyl]ethenyl]phenyl]phenyl]-3,5-dimethyl-N-phenylaniline |
|---|---|
| PubChem CID | 90921715 |
| Molecular Formula | C54H46N2 |
| Molecular Weight | 722.98 g/mol |
| Exact Mass | 722.37 |
| IUPAC Name | N-[4-[4-[2-[4-[4-(N-(3,5-dimethylphenyl)anilino)phenyl]phenyl]ethenyl]phenyl]phenyl]-3,5-dimethyl-N-phenylaniline |
| SMILES | Cc1cc(C)cc(N(c2ccccc2)c2ccc(-c3ccc(C=Cc4ccc(-c5ccc(N(c6ccccc6)c6cc(C)cc(C)c6)cc5)cc4)cc3)cc2)c1 |
| InChI | InChI=1S/C54H46N2/c1-39-33-40(2)36-53(35-39)55(49-11-7-5-8-12-49)51-29-25-47(26-30-51)45-21-17-43(18-22-45)15-16-44-19-23-46(24-20-44)48-27-31-52(32-28-48)56(50-13-9-6-10-14-50)54-37-41(3)34-42(4)38-54/h5-38H,1-4H3 |
| InChIKey | WXOSSNMJLQIYEG-UHFFFAOYSA-N |
| XLogP | 15.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.98 |
| LogP ≤ 5 | 15.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|