C48H42N2 — CID 91323757
N-(3,5-dimethylphenyl)-3,5-dimethyl-N-[4-[4-[2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]phenyl]aniline (PubChem CID 91323757) has the molecular formula C48H42N2 and a molecular weight of 646.88 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-3,5-dimethyl-N-[4-[4-[2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]phenyl]aniline.
| Compound Name | N-(3,5-dimethylphenyl)-3,5-dimethyl-N-[4-[4-[2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]phenyl]aniline |
|---|---|
| PubChem CID | 91323757 |
| Molecular Formula | C48H42N2 |
| Molecular Weight | 646.88 g/mol |
| Exact Mass | 646.33 |
| IUPAC Name | N-(3,5-dimethylphenyl)-3,5-dimethyl-N-[4-[4-[2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]phenyl]aniline |
| SMILES | Cc1cc(C)cc(N(c2ccc(-c3ccc(C=Cc4ccc(N(c5ccccc5)c5ccccc5)cc4)cc3)cc2)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C48H42N2/c1-35-29-36(2)32-47(31-35)50(48-33-37(3)30-38(4)34-48)46-27-23-42(24-28-46)41-21-17-39(18-22-41)15-16-40-19-25-45(26-20-40)49(43-11-7-5-8-12-43)44-13-9-6-10-14-44/h5-34H,1-4H3 |
| InChIKey | DANQXAUYSSZXJI-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.88 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|